N1-methylpseudouridine

$150.00

98%
CAS:
13860-38-3
Molecular Formula: C10H14N2O6
Molecular Weight: 258.23
InChI key: UVBYMVOUBXYSFV-XUTVFYLZSA-N
SMILES: O[C@H]1[C@@](O[C@H](CO)[C@H]1O)(C=2C(=O)NC(=O)N(C)C2)[H]
PubChem CID: 99543
IUPAC name: 5-[(2S,3R,4S,5R)-3,4-Dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1-methylpyrimidine-2,4-dione

Description

N1-methylpseudouridine

$150.00

Fill information here: